C36H44N2 — CID 22919219
4-[[4-[6-[4-[(4-aminophenyl)methyl]-3,5-dimethylphenyl]hexyl]-2,6-dimethylphenyl]methyl]aniline (PubChem CID 22919219) has the molecular formula C36H44N2 and a molecular weight of 504.76 g/mol. Its IUPAC name is 4-[[4-[6-[4-[(4-aminophenyl)methyl]-3,5-dimethylphenyl]hexyl]-2,6-dimethylphenyl]methyl]aniline.
| Compound Name | 4-[[4-[6-[4-[(4-aminophenyl)methyl]-3,5-dimethylphenyl]hexyl]-2,6-dimethylphenyl]methyl]aniline |
|---|---|
| PubChem CID | 22919219 |
| Molecular Formula | C36H44N2 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | 4-[[4-[6-[4-[(4-aminophenyl)methyl]-3,5-dimethylphenyl]hexyl]-2,6-dimethylphenyl]methyl]aniline |
| SMILES | Cc1cc(CCCCCCc2cc(C)c(Cc3ccc(N)cc3)c(C)c2)cc(C)c1Cc1ccc(N)cc1 |
| InChI | InChI=1S/C36H44N2/c1-25-19-31(20-26(2)35(25)23-29-11-15-33(37)16-12-29)9-7-5-6-8-10-32-21-27(3)36(28(4)22-32)24-30-13-17-34(38)18-14-30/h11-22H,5-10,23-24,37-38H2,1-4H3 |
| InChIKey | CQQMTQDXKVUZIJ-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|