C44H60N2 — CID 22919470
4-[[4-[10-[4-[(4-aminophenyl)methyl]-2,3,5,6-tetramethylphenyl]decyl]-2,3,5,6-tetramethylphenyl]methyl]aniline (PubChem CID 22919470) has the molecular formula C44H60N2 and a molecular weight of 616.98 g/mol. Its IUPAC name is 4-[[4-[10-[4-[(4-aminophenyl)methyl]-2,3,5,6-tetramethylphenyl]decyl]-2,3,5,6-tetramethylphenyl]methyl]aniline.
| Compound Name | 4-[[4-[10-[4-[(4-aminophenyl)methyl]-2,3,5,6-tetramethylphenyl]decyl]-2,3,5,6-tetramethylphenyl]methyl]aniline |
|---|---|
| PubChem CID | 22919470 |
| Molecular Formula | C44H60N2 |
| Molecular Weight | 616.98 g/mol |
| Exact Mass | 616.48 |
| IUPAC Name | 4-[[4-[10-[4-[(4-aminophenyl)methyl]-2,3,5,6-tetramethylphenyl]decyl]-2,3,5,6-tetramethylphenyl]methyl]aniline |
| SMILES | Cc1c(C)c(Cc2ccc(N)cc2)c(C)c(C)c1CCCCCCCCCCc1c(C)c(C)c(Cc2ccc(N)cc2)c(C)c1C |
| InChI | InChI=1S/C44H60N2/c1-29-33(5)43(27-37-19-23-39(45)24-20-37)34(6)30(2)41(29)17-15-13-11-9-10-12-14-16-18-42-31(3)35(7)44(36(8)32(42)4)28-38-21-25-40(46)26-22-38/h19-26H,9-18,27-28,45-46H2,1-8H3 |
| InChIKey | JXRXGULIGFGMOX-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.98 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|