C16H17W- — CID 147577515
4-(3,5-dimethylphenyl)-1,2-dimethylbenzene-6-ide;tungsten (PubChem CID 147577515) has the molecular formula C16H17W- and a molecular weight of 393.15 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-1,2-dimethylbenzene-6-ide;tungsten.
| Compound Name | 4-(3,5-dimethylphenyl)-1,2-dimethylbenzene-6-ide;tungsten |
|---|---|
| PubChem CID | 147577515 |
| Molecular Formula | C16H17W- |
| Molecular Weight | 393.15 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-1,2-dimethylbenzene-6-ide;tungsten |
| SMILES | Cc1cc(C)cc(-c2c[c-]c(C)c(C)c2)c1.[W] |
| InChI | InChI=1S/C16H17.W/c1-11-7-12(2)9-16(8-11)15-6-5-13(3)14(4)10-15;/h6-10H,1-4H3;/q-1; |
| InChIKey | IKBQLBDFEAKNGP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.15 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|