C14H13Y- — CID 59217668
1,3-dimethyl-5-phenylbenzene;yttrium (PubChem CID 59217668) has the molecular formula C14H13Y- and a molecular weight of 270.16 g/mol. Its IUPAC name is 1,3-dimethyl-5-phenylbenzene;yttrium.
| Compound Name | 1,3-dimethyl-5-phenylbenzene;yttrium |
|---|---|
| PubChem CID | 59217668 |
| Molecular Formula | C14H13Y- |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 1,3-dimethyl-5-phenylbenzene;yttrium |
| SMILES | Cc1cc(C)cc(-c2cc[c-]cc2)c1.[Y] |
| InChI | InChI=1S/C14H13.Y/c1-11-8-12(2)10-14(9-11)13-6-4-3-5-7-13;/h4-10H,1-2H3;/q-1; |
| InChIKey | FCYZCQSUAQTNGM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|