About 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium
1,3-dimethylbenzene-5-ide;methylbenzene;yttrium (PubChem CID 59372723) has the molecular formula C15H16Y-2
and a molecular weight of 285.20 g/mol. Its IUPAC name is 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium.
Molecular Properties
| Compound Name | 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium |
| PubChem CID | 59372723 |
| Molecular Formula | C15H16Y-2 |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium |
| SMILES | Cc1c[c-]cc(C)c1.Cc1cc[c-]cc1.[Y] |
| InChI | InChI=1S/C8H9.C7H7.Y/c1-7-4-3-5-8(2)6-7;1-7-5-3-2-4-6-7;/h4-6H,1-2H3;3-6H,1H3;/q2*-1; |
| InChIKey | HSEXDJZTXMZHMZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium?
The IUPAC name of 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium (CID 59372723) is 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium.
What is the SMILES notation for 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium?
The canonical SMILES for 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium is Cc1c[c-]cc(C)c1.Cc1cc[c-]cc1.[Y].
What is the InChIKey of 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium?
The InChIKey is HSEXDJZTXMZHMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9.C7H7.Y/c1-7-4-3-5-8(2)6-7;1-7-5-3-2-4-6-7;/h4-6H,1-2H3;3-6H,1H3;/q2*-1;.
What are the key properties of 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium?
1,3-dimethylbenzene-5-ide;methylbenzene;yttrium has a molecular weight of 285.20 g/mol, XLogP of 3.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylbenzene-5-ide;methylbenzene;yttrium is sourced from PubChem (CID 59372723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).