About methylbenzene;methylbenzene;rutherfordium
methylbenzene;methylbenzene;rutherfordium (PubChem CID 59021339) has the molecular formula C14H14Rf-2
and a molecular weight of 449.27 g/mol. Its IUPAC name is methylbenzene;methylbenzene;rutherfordium.
Molecular Properties
| Compound Name | methylbenzene;methylbenzene;rutherfordium |
| PubChem CID | 59021339 |
| Molecular Formula | C14H14Rf-2 |
| Molecular Weight | 449.27 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | methylbenzene;methylbenzene;rutherfordium |
| SMILES | Cc1c[c-]ccc1.Cc1cc[c-]cc1.[Rf] |
| InChI | InChI=1S/2C7H7.Rf/c2*1-7-5-3-2-4-6-7;/h3-6H,1H3;2-3,5-6H,1H3;/q2*-1; |
| InChIKey | AIZCXTAVOPPAAZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methylbenzene;methylbenzene;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylbenzene;methylbenzene;rutherfordium?
The IUPAC name of methylbenzene;methylbenzene;rutherfordium (CID 59021339) is methylbenzene;methylbenzene;rutherfordium.
What is the SMILES notation for methylbenzene;methylbenzene;rutherfordium?
The canonical SMILES for methylbenzene;methylbenzene;rutherfordium is Cc1c[c-]ccc1.Cc1cc[c-]cc1.[Rf].
What is the InChIKey of methylbenzene;methylbenzene;rutherfordium?
The InChIKey is AIZCXTAVOPPAAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H7.Rf/c2*1-7-5-3-2-4-6-7;/h3-6H,1H3;2-3,5-6H,1H3;/q2*-1;.
What are the key properties of methylbenzene;methylbenzene;rutherfordium?
methylbenzene;methylbenzene;rutherfordium has a molecular weight of 449.27 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methylbenzene;methylbenzene;rutherfordium is sourced from PubChem (CID 59021339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).