C15H17Bk- — CID 160800494
berkelium;methylbenzene;1,4-xylene (PubChem CID 160800494) has the molecular formula C15H17Bk- and a molecular weight of 444.30 g/mol. Its IUPAC name is berkelium;methylbenzene;1,4-xylene.
| Compound Name | berkelium;methylbenzene;1,4-xylene |
|---|---|
| PubChem CID | 160800494 |
| Molecular Formula | C15H17Bk- |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | berkelium;methylbenzene;1,4-xylene |
| SMILES | Cc1c[c-]ccc1.Cc1ccc(C)cc1.[Bk] |
| InChI | InChI=1S/C8H10.C7H7.Bk/c1-7-3-5-8(2)6-4-7;1-7-5-3-2-4-6-7;/h3-6H,1-2H3;2-3,5-6H,1H3;/q;-1; |
| InChIKey | VGGMMZCGYTWSBG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|