C14H12Y2-2 — CID 59217667
1,3-dimethyl-5-phenylbenzene;bis(yttrium) (PubChem CID 59217667) has the molecular formula C14H12Y2-2 and a molecular weight of 358.06 g/mol. Its IUPAC name is 1,3-dimethyl-5-phenylbenzene;bis(yttrium).
| Compound Name | 1,3-dimethyl-5-phenylbenzene;bis(yttrium) |
|---|---|
| PubChem CID | 59217667 |
| Molecular Formula | C14H12Y2-2 |
| Molecular Weight | 358.06 g/mol |
| Exact Mass | 357.91 |
| IUPAC Name | 1,3-dimethyl-5-phenylbenzene;bis(yttrium) |
| SMILES | Cc1cc(C)cc(-c2c[c-]c[c-]c2)c1.[Y].[Y] |
| InChI | InChI=1S/C14H12.2Y/c1-11-8-12(2)10-14(9-11)13-6-4-3-5-7-13;;/h3,6-10H,1-2H3;;/q-2;; |
| InChIKey | AAGLOSVSPTUYNU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.06 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|