C13H10F3N — CID 175818404
4-[[3-(difluoromethyl)-5-fluorophenyl]methyl]pyridine (PubChem CID 175818404) has the molecular formula C13H10F3N and a molecular weight of 237.22 g/mol. Its IUPAC name is 4-[[3-(difluoromethyl)-5-fluorophenyl]methyl]pyridine.
| Compound Name | 4-[[3-(difluoromethyl)-5-fluorophenyl]methyl]pyridine |
|---|---|
| PubChem CID | 175818404 |
| Molecular Formula | C13H10F3N |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 4-[[3-(difluoromethyl)-5-fluorophenyl]methyl]pyridine |
| SMILES | Fc1cc(Cc2ccncc2)cc(C(F)F)c1 |
| InChI | InChI=1S/C13H10F3N/c14-12-7-10(6-11(8-12)13(15)16)5-9-1-3-17-4-2-9/h1-4,6-8,13H,5H2 |
| InChIKey | KUGKNDPZCQKREC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |