C19H20F3N3O — CID 156852831
(2E)-2-[[[4-[[3-(difluoromethyl)-5-fluorophenyl]methyl]-2-pyridinyl]amino]methylidene]-3-(methylamino)butanal (PubChem CID 156852831) has the molecular formula C19H20F3N3O and a molecular weight of 363.38 g/mol. Its IUPAC name is (2E)-2-[[[4-[[3-(difluoromethyl)-5-fluorophenyl]methyl]-2-pyridinyl]amino]methylidene]-3-(methylamino)butanal.
| Compound Name | (2E)-2-[[[4-[[3-(difluoromethyl)-5-fluorophenyl]methyl]-2-pyridinyl]amino]methylidene]-3-(methylamino)butanal |
|---|---|
| PubChem CID | 156852831 |
| Molecular Formula | C19H20F3N3O |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (2E)-2-[[[4-[[3-(difluoromethyl)-5-fluorophenyl]methyl]-2-pyridinyl]amino]methylidene]-3-(methylamino)butanal |
| SMILES | CNC(C)/C(C=O)=C\Nc1cc(Cc2cc(F)cc(C(F)F)c2)ccn1 |
| InChI | InChI=1S/C19H20F3N3O/c1-12(23-2)16(11-26)10-25-18-8-13(3-4-24-18)5-14-6-15(19(21)22)9-17(20)7-14/h3-4,6-12,19,23H,5H2,1-2H3,(H,24,25)/b16-10- |
| InChIKey | PELFCJSQFYSJFT-YBEGLDIGSA-N |
| XLogP | 3.85 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|