C22H21F2N3O — CID 129214783
[1-[4-[(3,5-difluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindol-4-yl]-(methylamino)methanol (PubChem CID 129214783) has the molecular formula C22H21F2N3O and a molecular weight of 381.43 g/mol. Its IUPAC name is [1-[4-[(3,5-difluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindol-4-yl]-(methylamino)methanol.
| Compound Name | [1-[4-[(3,5-difluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindol-4-yl]-(methylamino)methanol |
|---|---|
| PubChem CID | 129214783 |
| Molecular Formula | C22H21F2N3O |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [1-[4-[(3,5-difluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindol-4-yl]-(methylamino)methanol |
| SMILES | CNC(O)c1cccc2c1CCN2c1cc(Cc2cc(F)cc(F)c2)ccn1 |
| InChI | InChI=1S/C22H21F2N3O/c1-25-22(28)19-3-2-4-20-18(19)6-8-27(20)21-12-14(5-7-26-21)9-15-10-16(23)13-17(24)11-15/h2-5,7,10-13,22,25,28H,6,8-9H2,1H3 |
| InChIKey | VRTLRVIZJIZLRD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|