C26H22F3N5O — CID 122653586
N-(2-imidazol-1-ylethyl)-1-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide (PubChem CID 122653586) has the molecular formula C26H22F3N5O and a molecular weight of 477.49 g/mol. Its IUPAC name is N-(2-imidazol-1-ylethyl)-1-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide.
| Compound Name | N-(2-imidazol-1-ylethyl)-1-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 122653586 |
| Molecular Formula | C26H22F3N5O |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-(2-imidazol-1-ylethyl)-1-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide |
| SMILES | O=C(NCCn1ccnc1)c1cccc2c1CCN2c1cc(Cc2cc(F)c(F)c(F)c2)ccn1 |
| InChI | InChI=1S/C26H22F3N5O/c27-21-13-18(14-22(28)25(21)29)12-17-4-6-31-24(15-17)34-9-5-19-20(2-1-3-23(19)34)26(35)32-8-11-33-10-7-30-16-33/h1-4,6-7,10,13-16H,5,8-9,11-12H2,(H,32,35) |
| InChIKey | OSPZFSFFDGEHII-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|