C24H21F4N3O2 — CID 145181558
5-fluoro-N-(3-hydroxypropyl)-1-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide (PubChem CID 145181558) has the molecular formula C24H21F4N3O2 and a molecular weight of 459.44 g/mol. Its IUPAC name is 5-fluoro-N-(3-hydroxypropyl)-1-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide.
| Compound Name | 5-fluoro-N-(3-hydroxypropyl)-1-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 145181558 |
| Molecular Formula | C24H21F4N3O2 |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 5-fluoro-N-(3-hydroxypropyl)-1-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide |
| SMILES | O=C(NCCCO)c1c(F)ccc2c1CCN2c1cc(Cc2cc(F)c(F)c(F)c2)ccn1 |
| InChI | InChI=1S/C24H21F4N3O2/c25-17-2-3-20-16(22(17)24(33)30-6-1-9-32)5-8-31(20)21-13-14(4-7-29-21)10-15-11-18(26)23(28)19(27)12-15/h2-4,7,11-13,32H,1,5-6,8-10H2,(H,30,33) |
| InChIKey | CVJYVQPAIHAMLP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|