C27H27F3N4O2 — CID 122660770
N-[5-(methylamino)-5-oxopentyl]-1-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide (PubChem CID 122660770) has the molecular formula C27H27F3N4O2 and a molecular weight of 496.53 g/mol. Its IUPAC name is N-[5-(methylamino)-5-oxopentyl]-1-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide.
| Compound Name | N-[5-(methylamino)-5-oxopentyl]-1-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 122660770 |
| Molecular Formula | C27H27F3N4O2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-[5-(methylamino)-5-oxopentyl]-1-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide |
| SMILES | CNC(=O)CCCCNC(=O)c1cccc2c1CCN2c1cc(Cc2cc(F)c(F)c(F)c2)ccn1 |
| InChI | InChI=1S/C27H27F3N4O2/c1-31-25(35)7-2-3-10-33-27(36)20-5-4-6-23-19(20)9-12-34(23)24-16-17(8-11-32-24)13-18-14-21(28)26(30)22(29)15-18/h4-6,8,11,14-16H,2-3,7,9-10,12-13H2,1H3,(H,31,35)(H,33,36) |
| InChIKey | JSCFDNNOFXJBCK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|