C21H22F4N4O3 — CID 167515457
[(E)-3-carbamoyl-2-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-4-(methylamino)pent-2-enyl] formate (PubChem CID 167515457) has the molecular formula C21H22F4N4O3 and a molecular weight of 454.42 g/mol. Its IUPAC name is [(E)-3-carbamoyl-2-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-4-(methylamino)pent-2-enyl] formate.
| Compound Name | [(E)-3-carbamoyl-2-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-4-(methylamino)pent-2-enyl] formate |
|---|---|
| PubChem CID | 167515457 |
| Molecular Formula | C21H22F4N4O3 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | [(E)-3-carbamoyl-2-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-4-(methylamino)pent-2-enyl] formate |
| SMILES | CNC(C)/C(C(N)=O)=C(/COC=O)Nc1cc(Cc2cc(F)cc(C(F)(F)F)c2)ccn1 |
| InChI | InChI=1S/C21H22F4N4O3/c1-12(27-2)19(20(26)31)17(10-32-11-30)29-18-8-13(3-4-28-18)5-14-6-15(21(23,24)25)9-16(22)7-14/h3-4,6-9,11-12,27H,5,10H2,1-2H3,(H2,26,31)(H,28,29)/b19-17+ |
| InChIKey | QYZWPQOREYVWFZ-HTXNQAPBSA-N |
| XLogP | 2.76 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|