C19H18F4N4O — CID 162739859
3-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-2-hydrazinylcyclohex-2-en-1-one (PubChem CID 162739859) has the molecular formula C19H18F4N4O and a molecular weight of 394.37 g/mol. Its IUPAC name is 3-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-2-hydrazinylcyclohex-2-en-1-one.
| Compound Name | 3-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-2-hydrazinylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 162739859 |
| Molecular Formula | C19H18F4N4O |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-2-hydrazinylcyclohex-2-en-1-one |
| SMILES | NNC1=C(Nc2cc(Cc3cc(F)cc(C(F)(F)F)c3)ccn2)CCCC1=O |
| InChI | InChI=1S/C19H18F4N4O/c20-14-8-12(7-13(10-14)19(21,22)23)6-11-4-5-25-17(9-11)26-15-2-1-3-16(28)18(15)27-24/h4-5,7-10,27H,1-3,6,24H2,(H,25,26) |
| InChIKey | NMQHAGAUDZTELR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|