C22H25F4N5O — CID 162739870
3-[amino-[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-1-N-(oxetan-3-yl)cyclohex-2-ene-1,2-diamine (PubChem CID 162739870) has the molecular formula C22H25F4N5O and a molecular weight of 451.47 g/mol. Its IUPAC name is 3-[amino-[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-1-N-(oxetan-3-yl)cyclohex-2-ene-1,2-diamine.
| Compound Name | 3-[amino-[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-1-N-(oxetan-3-yl)cyclohex-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 162739870 |
| Molecular Formula | C22H25F4N5O |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 3-[amino-[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-1-N-(oxetan-3-yl)cyclohex-2-ene-1,2-diamine |
| SMILES | NC1=C(N(N)c2cc(Cc3cc(F)cc(C(F)(F)F)c3)ccn2)CCCC1NC1COC1 |
| InChI | InChI=1S/C22H25F4N5O/c23-16-8-14(7-15(10-16)22(24,25)26)6-13-4-5-29-20(9-13)31(28)19-3-1-2-18(21(19)27)30-17-11-32-12-17/h4-5,7-10,17-18,30H,1-3,6,11-12,27-28H2 |
| InChIKey | BZDQOUVRKLUGSX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|