C18H19F4N5O — CID 162739849
3-[amino-[4-[3-fluoro-5-(trifluoromethyl)phenoxy]-2-pyridinyl]amino]cyclohex-2-ene-1,2-diamine (PubChem CID 162739849) has the molecular formula C18H19F4N5O and a molecular weight of 397.38 g/mol. Its IUPAC name is 3-[amino-[4-[3-fluoro-5-(trifluoromethyl)phenoxy]-2-pyridinyl]amino]cyclohex-2-ene-1,2-diamine.
| Compound Name | 3-[amino-[4-[3-fluoro-5-(trifluoromethyl)phenoxy]-2-pyridinyl]amino]cyclohex-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 162739849 |
| Molecular Formula | C18H19F4N5O |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-[amino-[4-[3-fluoro-5-(trifluoromethyl)phenoxy]-2-pyridinyl]amino]cyclohex-2-ene-1,2-diamine |
| SMILES | NC1=C(N(N)c2cc(Oc3cc(F)cc(C(F)(F)F)c3)ccn2)CCCC1N |
| InChI | InChI=1S/C18H19F4N5O/c19-11-6-10(18(20,21)22)7-13(8-11)28-12-4-5-26-16(9-12)27(25)15-3-1-2-14(23)17(15)24/h4-9,14H,1-3,23-25H2 |
| InChIKey | CFBDBSAUEKNCDX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|