C19H16F4N4O2 — CID 156735554
4-[[4-[3-fluoro-5-(trifluoromethyl)phenoxy]-2-pyridinyl]-(methylideneamino)amino]-5-methyl-2,3-dihydro-1H-pyridin-6-one (PubChem CID 156735554) has the molecular formula C19H16F4N4O2 and a molecular weight of 408.36 g/mol. Its IUPAC name is 4-[[4-[3-fluoro-5-(trifluoromethyl)phenoxy]-2-pyridinyl]-(methylideneamino)amino]-5-methyl-2,3-dihydro-1H-pyridin-6-one.
| Compound Name | 4-[[4-[3-fluoro-5-(trifluoromethyl)phenoxy]-2-pyridinyl]-(methylideneamino)amino]-5-methyl-2,3-dihydro-1H-pyridin-6-one |
|---|---|
| PubChem CID | 156735554 |
| Molecular Formula | C19H16F4N4O2 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 4-[[4-[3-fluoro-5-(trifluoromethyl)phenoxy]-2-pyridinyl]-(methylideneamino)amino]-5-methyl-2,3-dihydro-1H-pyridin-6-one |
| SMILES | C=NN(C1=C(C)C(=O)NCC1)c1cc(Oc2cc(F)cc(C(F)(F)F)c2)ccn1 |
| InChI | InChI=1S/C19H16F4N4O2/c1-11-16(4-6-26-18(11)28)27(24-2)17-10-14(3-5-25-17)29-15-8-12(19(21,22)23)7-13(20)9-15/h3,5,7-10H,2,4,6H2,1H3,(H,26,28) |
| InChIKey | MQACPAPIEBWUAE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|