C21H23F4N5O — CID 162739866
N-[3-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-2-hydrazinylcyclohex-2-en-1-yl]acetamide (PubChem CID 162739866) has the molecular formula C21H23F4N5O and a molecular weight of 437.44 g/mol. Its IUPAC name is N-[3-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-2-hydrazinylcyclohex-2-en-1-yl]acetamide.
| Compound Name | N-[3-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-2-hydrazinylcyclohex-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 162739866 |
| Molecular Formula | C21H23F4N5O |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-[3-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]amino]-2-hydrazinylcyclohex-2-en-1-yl]acetamide |
| SMILES | CC(=O)NC1CCCC(Nc2cc(Cc3cc(F)cc(C(F)(F)F)c3)ccn2)=C1NN |
| InChI | InChI=1S/C21H23F4N5O/c1-12(31)28-17-3-2-4-18(20(17)30-26)29-19-10-13(5-6-27-19)7-14-8-15(21(23,24)25)11-16(22)9-14/h5-6,8-11,17,30H,2-4,7,26H2,1H3,(H,27,29)(H,28,31) |
| InChIKey | UYCDMMZTVGESIB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|