C17H16F4N4O — CID 156852805
(2E)-2-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]hydrazinylidene]-3-(methylamino)propanal (PubChem CID 156852805) has the molecular formula C17H16F4N4O and a molecular weight of 368.33 g/mol. Its IUPAC name is (2E)-2-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]hydrazinylidene]-3-(methylamino)propanal.
| Compound Name | (2E)-2-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]hydrazinylidene]-3-(methylamino)propanal |
|---|---|
| PubChem CID | 156852805 |
| Molecular Formula | C17H16F4N4O |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (2E)-2-[[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]hydrazinylidene]-3-(methylamino)propanal |
| SMILES | CNC/C(C=O)=N\Nc1cc(Cc2cc(F)cc(C(F)(F)F)c2)ccn1 |
| InChI | InChI=1S/C17H16F4N4O/c1-22-9-15(10-26)24-25-16-7-11(2-3-23-16)4-12-5-13(17(19,20)21)8-14(18)6-12/h2-3,5-8,10,22H,4,9H2,1H3,(H,23,25)/b24-15+ |
| InChIKey | KIEGGDTZNPVGSV-BUVRLJJBSA-N |
| XLogP | 3.02 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|