C54H40F12N12O7P+ — CID 171615178
tris[[4-carbamoyl-1-[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]-3-methylpyrazol-5-yl]oxy]-hydroxyphosphanium (PubChem CID 171615178) has the molecular formula C54H40F12N12O7P+ and a molecular weight of 1227.94 g/mol. Its IUPAC name is tris[[4-carbamoyl-1-[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]-3-methylpyrazol-5-yl]oxy]-hydroxyphosphanium.
| Compound Name | tris[[4-carbamoyl-1-[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]-3-methylpyrazol-5-yl]oxy]-hydroxyphosphanium |
|---|---|
| PubChem CID | 171615178 |
| Molecular Formula | C54H40F12N12O7P+ |
| Molecular Weight | 1227.94 g/mol |
| Exact Mass | 1227.27 |
| IUPAC Name | tris[[4-carbamoyl-1-[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]-3-methylpyrazol-5-yl]oxy]-hydroxyphosphanium |
| SMILES | Cc1nn(-c2cc(Cc3cc(F)cc(C(F)(F)F)c3)ccn2)c(O[P+](O)(Oc2c(C(N)=O)c(C)nn2-c2cc(Cc3cc(F)cc(C(F)(F)F)c3)ccn2)Oc2c(C(N)=O)c(C)nn2-c2cc(Cc3cc(F)cc(C(F)(F)F)c3)ccn2)c1C(N)=O |
| InChI | InChI=1S/C54H39F12N12O7P/c1-25-43(46(67)79)49(76(73-25)40-19-28(4-7-70-40)10-31-13-34(52(58,59)60)22-37(55)16-31)83-86(82,84-50-44(47(68)80)26(2)74-77(50)41-20-29(5-8-71-41)11-32-14-35(53(61,62)63)23-38(56)17-32)85-51-45(48(69)81)27(3)75-78(51)42-21-30(6-9-72-42)12-33-15-36(54(64,65)66)24-39(57)18-33/h4-9,13-24,82H,10-12H2,1-3H3,(H5-,67,68,69,79,80,81)/p+1 |
| InChIKey | OWHPMBLKTPJMKY-UHFFFAOYSA-O |
| XLogP | 10.10 |
| TPSA | 269.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1227.94 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|