C16H24Cl3N — CID 105350355
3,3-dimethyl-N-propyl-5-(2,4,6-trichlorophenyl)pentan-1-amine (PubChem CID 105350355) has the molecular formula C16H24Cl3N and a molecular weight of 336.73 g/mol. Its IUPAC name is 3,3-dimethyl-N-propyl-5-(2,4,6-trichlorophenyl)pentan-1-amine.
| Compound Name | 3,3-dimethyl-N-propyl-5-(2,4,6-trichlorophenyl)pentan-1-amine |
|---|---|
| PubChem CID | 105350355 |
| Molecular Formula | C16H24Cl3N |
| Molecular Weight | 336.73 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 3,3-dimethyl-N-propyl-5-(2,4,6-trichlorophenyl)pentan-1-amine |
| SMILES | CCCNCCC(C)(C)CCc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H24Cl3N/c1-4-8-20-9-7-16(2,3)6-5-13-14(18)10-12(17)11-15(13)19/h10-11,20H,4-9H2,1-3H3 |
| InChIKey | NPCOYVDOOGSDGG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.73 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|