C13H21BrClNS — CID 80532626
5-(5-bromo-4-chlorothiophen-2-yl)-N-ethyl-3,3-dimethylpentan-1-amine (PubChem CID 80532626) has the molecular formula C13H21BrClNS and a molecular weight of 338.74 g/mol. Its IUPAC name is 5-(5-bromo-4-chlorothiophen-2-yl)-N-ethyl-3,3-dimethylpentan-1-amine.
| Compound Name | 5-(5-bromo-4-chlorothiophen-2-yl)-N-ethyl-3,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 80532626 |
| Molecular Formula | C13H21BrClNS |
| Molecular Weight | 338.74 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 5-(5-bromo-4-chlorothiophen-2-yl)-N-ethyl-3,3-dimethylpentan-1-amine |
| SMILES | CCNCCC(C)(C)CCc1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C13H21BrClNS/c1-4-16-8-7-13(2,3)6-5-10-9-11(15)12(14)17-10/h9,16H,4-8H2,1-3H3 |
| InChIKey | FLOIGVLOZDOWHO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.74 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|