C15H23Br2N — CID 65304999
5-(2,5-dibromophenyl)-N-ethyl-3,3-dimethylpentan-1-amine (PubChem CID 65304999) has the molecular formula C15H23Br2N and a molecular weight of 377.16 g/mol. Its IUPAC name is 5-(2,5-dibromophenyl)-N-ethyl-3,3-dimethylpentan-1-amine.
| Compound Name | 5-(2,5-dibromophenyl)-N-ethyl-3,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 65304999 |
| Molecular Formula | C15H23Br2N |
| Molecular Weight | 377.16 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 5-(2,5-dibromophenyl)-N-ethyl-3,3-dimethylpentan-1-amine |
| SMILES | CCNCCC(C)(C)CCc1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H23Br2N/c1-4-18-10-9-15(2,3)8-7-12-11-13(16)5-6-14(12)17/h5-6,11,18H,4,7-10H2,1-3H3 |
| InChIKey | QYXYQLSBWDESGT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.16 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|