C13H19Br2N — CID 65305623
4-(2,5-dibromophenyl)-N-propylbutan-1-amine (PubChem CID 65305623) has the molecular formula C13H19Br2N and a molecular weight of 349.11 g/mol. Its IUPAC name is 4-(2,5-dibromophenyl)-N-propylbutan-1-amine.
| Compound Name | 4-(2,5-dibromophenyl)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 65305623 |
| Molecular Formula | C13H19Br2N |
| Molecular Weight | 349.11 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 4-(2,5-dibromophenyl)-N-propylbutan-1-amine |
| SMILES | CCCNCCCCc1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H19Br2N/c1-2-8-16-9-4-3-5-11-10-12(14)6-7-13(11)15/h6-7,10,16H,2-5,8-9H2,1H3 |
| InChIKey | VYAPNCJZVBNRKF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.11 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|