C14H21Br2N — CID 65300495
5-(2,5-dibromophenyl)-N-propylpentan-1-amine (PubChem CID 65300495) has the molecular formula C14H21Br2N and a molecular weight of 363.14 g/mol. Its IUPAC name is 5-(2,5-dibromophenyl)-N-propylpentan-1-amine.
| Compound Name | 5-(2,5-dibromophenyl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 65300495 |
| Molecular Formula | C14H21Br2N |
| Molecular Weight | 363.14 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 5-(2,5-dibromophenyl)-N-propylpentan-1-amine |
| SMILES | CCCNCCCCCc1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H21Br2N/c1-2-9-17-10-5-3-4-6-12-11-13(15)7-8-14(12)16/h7-8,11,17H,2-6,9-10H2,1H3 |
| InChIKey | HZNVSPKACNEQAP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.14 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|