C11H16Br2N2 — CID 114369384
N'-[(2,5-dibromophenyl)methyl]-N-methylpropane-1,3-diamine (PubChem CID 114369384) has the molecular formula C11H16Br2N2 and a molecular weight of 336.07 g/mol. Its IUPAC name is N'-[(2,5-dibromophenyl)methyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[(2,5-dibromophenyl)methyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 114369384 |
| Molecular Formula | C11H16Br2N2 |
| Molecular Weight | 336.07 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | N'-[(2,5-dibromophenyl)methyl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNCc1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H16Br2N2/c1-14-5-2-6-15-8-9-7-10(12)3-4-11(9)13/h3-4,7,14-15H,2,5-6,8H2,1H3 |
| InChIKey | CXBOGPSOEUQLSP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.07 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|