C11H16BrNS — CID 115224928
3-[(5-bromo-2-methylphenyl)methylamino]propane-1-thiol (PubChem CID 115224928) has the molecular formula C11H16BrNS and a molecular weight of 274.23 g/mol. Its IUPAC name is 3-[(5-bromo-2-methylphenyl)methylamino]propane-1-thiol.
| Compound Name | 3-[(5-bromo-2-methylphenyl)methylamino]propane-1-thiol |
|---|---|
| PubChem CID | 115224928 |
| Molecular Formula | C11H16BrNS |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 3-[(5-bromo-2-methylphenyl)methylamino]propane-1-thiol |
| SMILES | Cc1ccc(Br)cc1CNCCCS |
| InChI | InChI=1S/C11H16BrNS/c1-9-3-4-11(12)7-10(9)8-13-5-2-6-14/h3-4,7,13-14H,2,5-6,8H2,1H3 |
| InChIKey | CDGCBWONBQCJBJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|