About 5-(2,5-dibromophenyl)pentan-1-amine
5-(2,5-dibromophenyl)pentan-1-amine (PubChem CID 65301153) has the molecular formula C11H15Br2N
and a molecular weight of 321.06 g/mol. Its IUPAC name is 5-(2,5-dibromophenyl)pentan-1-amine.
Molecular Properties
| Compound Name | 5-(2,5-dibromophenyl)pentan-1-amine |
| PubChem CID | 65301153 |
| Molecular Formula | C11H15Br2N |
| Molecular Weight | 321.06 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 5-(2,5-dibromophenyl)pentan-1-amine |
| SMILES | NCCCCCc1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H15Br2N/c12-10-5-6-11(13)9(8-10)4-2-1-3-7-14/h5-6,8H,1-4,7,14H2 |
| InChIKey | VKFUPWYBLUITDL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.06 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,5-dibromophenyl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dibromophenyl)pentan-1-amine?
The IUPAC name of 5-(2,5-dibromophenyl)pentan-1-amine (CID 65301153) is 5-(2,5-dibromophenyl)pentan-1-amine.
What is the SMILES notation for 5-(2,5-dibromophenyl)pentan-1-amine?
The canonical SMILES for 5-(2,5-dibromophenyl)pentan-1-amine is NCCCCCc1cc(Br)ccc1Br.
What is the InChIKey of 5-(2,5-dibromophenyl)pentan-1-amine?
The InChIKey is VKFUPWYBLUITDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Br2N/c12-10-5-6-11(13)9(8-10)4-2-1-3-7-14/h5-6,8H,1-4,7,14H2.
What are the key properties of 5-(2,5-dibromophenyl)pentan-1-amine?
5-(2,5-dibromophenyl)pentan-1-amine has a molecular weight of 321.06 g/mol, XLogP of 3.88, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dibromophenyl)pentan-1-amine is sourced from PubChem (CID 65301153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).