C11H15Br2N — CID 65301153
5-(2,5-dibromophenyl)pentan-1-amine (PubChem CID 65301153) has the molecular formula C11H15Br2N and a molecular weight of 321.06 g/mol. Its IUPAC name is 5-(2,5-dibromophenyl)pentan-1-amine.
| Compound Name | 5-(2,5-dibromophenyl)pentan-1-amine |
|---|---|
| PubChem CID | 65301153 |
| Molecular Formula | C11H15Br2N |
| Molecular Weight | 321.06 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 5-(2,5-dibromophenyl)pentan-1-amine |
| SMILES | NCCCCCc1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H15Br2N/c12-10-5-6-11(13)9(8-10)4-2-1-3-7-14/h5-6,8H,1-4,7,14H2 |
| InChIKey | VKFUPWYBLUITDL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.06 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|