C16H25BrFNO — CID 103396878
5-(5-bromo-4-fluoro-2-methoxyphenyl)-N-ethyl-3,3-dimethylpentan-1-amine (PubChem CID 103396878) has the molecular formula C16H25BrFNO and a molecular weight of 346.28 g/mol. Its IUPAC name is 5-(5-bromo-4-fluoro-2-methoxyphenyl)-N-ethyl-3,3-dimethylpentan-1-amine.
| Compound Name | 5-(5-bromo-4-fluoro-2-methoxyphenyl)-N-ethyl-3,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 103396878 |
| Molecular Formula | C16H25BrFNO |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 5-(5-bromo-4-fluoro-2-methoxyphenyl)-N-ethyl-3,3-dimethylpentan-1-amine |
| SMILES | CCNCCC(C)(C)CCc1cc(Br)c(F)cc1OC |
| InChI | InChI=1S/C16H25BrFNO/c1-5-19-9-8-16(2,3)7-6-12-10-13(17)14(18)11-15(12)20-4/h10-11,19H,5-9H2,1-4H3 |
| InChIKey | LTMNBLWLDKQBGY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|