C16H25Br2NO — CID 65305047
5-(2,5-dibromophenyl)-N-(2-methoxyethyl)-3,3-dimethylpentan-1-amine (PubChem CID 65305047) has the molecular formula C16H25Br2NO and a molecular weight of 407.19 g/mol. Its IUPAC name is 5-(2,5-dibromophenyl)-N-(2-methoxyethyl)-3,3-dimethylpentan-1-amine.
| Compound Name | 5-(2,5-dibromophenyl)-N-(2-methoxyethyl)-3,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 65305047 |
| Molecular Formula | C16H25Br2NO |
| Molecular Weight | 407.19 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 5-(2,5-dibromophenyl)-N-(2-methoxyethyl)-3,3-dimethylpentan-1-amine |
| SMILES | COCCNCCC(C)(C)CCc1cc(Br)ccc1Br |
| InChI | InChI=1S/C16H25Br2NO/c1-16(2,8-9-19-10-11-20-3)7-6-13-12-14(17)4-5-15(13)18/h4-5,12,19H,6-11H2,1-3H3 |
| InChIKey | GNJUMHQOZABONR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.19 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|