C15H26BrNS — CID 79990855
5-(5-bromo-4-methylthiophen-2-yl)-3,3-dimethyl-N-propylpentan-1-amine (PubChem CID 79990855) has the molecular formula C15H26BrNS and a molecular weight of 332.35 g/mol. Its IUPAC name is 5-(5-bromo-4-methylthiophen-2-yl)-3,3-dimethyl-N-propylpentan-1-amine.
| Compound Name | 5-(5-bromo-4-methylthiophen-2-yl)-3,3-dimethyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 79990855 |
| Molecular Formula | C15H26BrNS |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 5-(5-bromo-4-methylthiophen-2-yl)-3,3-dimethyl-N-propylpentan-1-amine |
| SMILES | CCCNCCC(C)(C)CCc1cc(C)c(Br)s1 |
| InChI | InChI=1S/C15H26BrNS/c1-5-9-17-10-8-15(3,4)7-6-13-11-12(2)14(16)18-13/h11,17H,5-10H2,1-4H3 |
| InChIKey | VAKUTZZGMPOCJE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|