C18H30FN — CID 65308821
5-(4-fluoro-3,5-dimethylphenyl)-3,3-dimethyl-N-propylpentan-1-amine (PubChem CID 65308821) has the molecular formula C18H30FN and a molecular weight of 279.44 g/mol. Its IUPAC name is 5-(4-fluoro-3,5-dimethylphenyl)-3,3-dimethyl-N-propylpentan-1-amine.
| Compound Name | 5-(4-fluoro-3,5-dimethylphenyl)-3,3-dimethyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 65308821 |
| Molecular Formula | C18H30FN |
| Molecular Weight | 279.44 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | 5-(4-fluoro-3,5-dimethylphenyl)-3,3-dimethyl-N-propylpentan-1-amine |
| SMILES | CCCNCCC(C)(C)CCc1cc(C)c(F)c(C)c1 |
| InChI | InChI=1S/C18H30FN/c1-6-10-20-11-9-18(4,5)8-7-16-12-14(2)17(19)15(3)13-16/h12-13,20H,6-11H2,1-5H3 |
| InChIKey | XYYYDVUVZGGJSW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|