C16H24N2 — CID 84631671
3-methyl-3-(2,5,7-trimethyl-1H-indol-3-yl)butan-1-amine (PubChem CID 84631671) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-methyl-3-(2,5,7-trimethyl-1H-indol-3-yl)butan-1-amine.
| Compound Name | 3-methyl-3-(2,5,7-trimethyl-1H-indol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 84631671 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 3-methyl-3-(2,5,7-trimethyl-1H-indol-3-yl)butan-1-amine |
| SMILES | Cc1cc(C)c2[nH]c(C)c(C(C)(C)CCN)c2c1 |
| InChI | InChI=1S/C16H24N2/c1-10-8-11(2)15-13(9-10)14(12(3)18-15)16(4,5)6-7-17/h8-9,18H,6-7,17H2,1-5H3 |
| InChIKey | WONXBVMVXKURND-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |