C17H23N3 — CID 162094017
N-[[3-(2-aminoethyl)-5,7-dimethyl-1H-indol-2-yl]methyl]-N-methylprop-2-yn-1-amine (PubChem CID 162094017) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is N-[[3-(2-aminoethyl)-5,7-dimethyl-1H-indol-2-yl]methyl]-N-methylprop-2-yn-1-amine.
| Compound Name | N-[[3-(2-aminoethyl)-5,7-dimethyl-1H-indol-2-yl]methyl]-N-methylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 162094017 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | N-[[3-(2-aminoethyl)-5,7-dimethyl-1H-indol-2-yl]methyl]-N-methylprop-2-yn-1-amine |
| SMILES | C#CCN(C)Cc1[nH]c2c(C)cc(C)cc2c1CCN |
| InChI | InChI=1S/C17H23N3/c1-5-8-20(4)11-16-14(6-7-18)15-10-12(2)9-13(3)17(15)19-16/h1,9-10,19H,6-8,11,18H2,2-4H3 |
| InChIKey | HQGJWALFDVEVPR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|