About 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid
2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid (PubChem CID 19848354) has the molecular formula C11H10Cl3NO5
and a molecular weight of 342.56 g/mol. Its IUPAC name is 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid |
| PubChem CID | 19848354 |
| Molecular Formula | C11H10Cl3NO5 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid |
| SMILES | NC(=O)c1c(Cl)cc(Cl)c(OCCOCC(=O)O)c1Cl |
| InChI | InChI=1S/C11H10Cl3NO5/c12-5-3-6(13)10(9(14)8(5)11(15)18)20-2-1-19-4-7(16)17/h3H,1-2,4H2,(H2,15,18)(H,16,17) |
| InChIKey | SSMDSXNIBDGZQL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid?
The IUPAC name of 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid (CID 19848354) is 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid.
What is the SMILES notation for 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid?
The canonical SMILES for 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid is NC(=O)c1c(Cl)cc(Cl)c(OCCOCC(=O)O)c1Cl.
What is the InChIKey of 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid?
The InChIKey is SSMDSXNIBDGZQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl3NO5/c12-5-3-6(13)10(9(14)8(5)11(15)18)20-2-1-19-4-7(16)17/h3H,1-2,4H2,(H2,15,18)(H,16,17).
What are the key properties of 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid?
2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid has a molecular weight of 342.56 g/mol, XLogP of 2.23, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid is sourced from PubChem (CID 19848354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).