C11H10Cl3NO5 — CID 19848354
2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid (PubChem CID 19848354) has the molecular formula C11H10Cl3NO5 and a molecular weight of 342.56 g/mol. Its IUPAC name is 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid.
| Compound Name | 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid |
|---|---|
| PubChem CID | 19848354 |
| Molecular Formula | C11H10Cl3NO5 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetic acid |
| SMILES | NC(=O)c1c(Cl)cc(Cl)c(OCCOCC(=O)O)c1Cl |
| InChI | InChI=1S/C11H10Cl3NO5/c12-5-3-6(13)10(9(14)8(5)11(15)18)20-2-1-19-4-7(16)17/h3H,1-2,4H2,(H2,15,18)(H,16,17) |
| InChIKey | SSMDSXNIBDGZQL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|