C12H15Cl2NO4 — CID 103996535
ethyl 6-amino-2,4-dichloro-3-(2-methoxyethoxy)benzoate (PubChem CID 103996535) has the molecular formula C12H15Cl2NO4 and a molecular weight of 308.16 g/mol. Its IUPAC name is ethyl 6-amino-2,4-dichloro-3-(2-methoxyethoxy)benzoate.
| Compound Name | ethyl 6-amino-2,4-dichloro-3-(2-methoxyethoxy)benzoate |
|---|---|
| PubChem CID | 103996535 |
| Molecular Formula | C12H15Cl2NO4 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | ethyl 6-amino-2,4-dichloro-3-(2-methoxyethoxy)benzoate |
| SMILES | CCOC(=O)c1c(N)cc(Cl)c(OCCOC)c1Cl |
| InChI | InChI=1S/C12H15Cl2NO4/c1-3-18-12(16)9-8(15)6-7(13)11(10(9)14)19-5-4-17-2/h6H,3-5,15H2,1-2H3 |
| InChIKey | TUPOVFXNQWKIMS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|