C11H9Cl3NNaO5 — CID 88620129
sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate (PubChem CID 88620129) has the molecular formula C11H9Cl3NNaO5 and a molecular weight of 364.54 g/mol. Its IUPAC name is sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate.
| Compound Name | sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 88620129 |
| Molecular Formula | C11H9Cl3NNaO5 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate |
| SMILES | NC(=O)c1c(Cl)cc(Cl)c(OCCOCC(=O)[O-])c1Cl.[Na+] |
| InChI | InChI=1S/C11H10Cl3NO5.Na/c12-5-3-6(13)10(9(14)8(5)11(15)18)20-2-1-19-4-7(16)17;/h3H,1-2,4H2,(H2,15,18)(H,16,17);/q;+1/p-1 |
| InChIKey | OCJAWUDPHCWPRG-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|