About sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate
sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate (PubChem CID 88620129) has the molecular formula C11H9Cl3NNaO5
and a molecular weight of 364.54 g/mol. Its IUPAC name is sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate.
Molecular Properties
| Compound Name | sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate |
| PubChem CID | 88620129 |
| Molecular Formula | C11H9Cl3NNaO5 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate |
| SMILES | NC(=O)c1c(Cl)cc(Cl)c(OCCOCC(=O)[O-])c1Cl.[Na+] |
| InChI | InChI=1S/C11H10Cl3NO5.Na/c12-5-3-6(13)10(9(14)8(5)11(15)18)20-2-1-19-4-7(16)17;/h3H,1-2,4H2,(H2,15,18)(H,16,17);/q;+1/p-1 |
| InChIKey | OCJAWUDPHCWPRG-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate?
The IUPAC name of sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate (CID 88620129) is sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate.
What is the SMILES notation for sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate?
The canonical SMILES for sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate is NC(=O)c1c(Cl)cc(Cl)c(OCCOCC(=O)[O-])c1Cl.[Na+].
What is the InChIKey of sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate?
The InChIKey is OCJAWUDPHCWPRG-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H10Cl3NO5.Na/c12-5-3-6(13)10(9(14)8(5)11(15)18)20-2-1-19-4-7(16)17;/h3H,1-2,4H2,(H2,15,18)(H,16,17);/q;+1/p-1.
What are the key properties of sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate?
sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate has a molecular weight of 364.54 g/mol, XLogP of -2.11, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-[2-(3-carbamoyl-2,4,6-trichlorophenoxy)ethoxy]acetate is sourced from PubChem (CID 88620129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).