C15H16Cl2O3 — CID 88965217
2-(4,6-dichloro-2-ethenyl-3-methylphenoxy)ethyl 2-methylprop-2-enoate (PubChem CID 88965217) has the molecular formula C15H16Cl2O3 and a molecular weight of 315.20 g/mol. Its IUPAC name is 2-(4,6-dichloro-2-ethenyl-3-methylphenoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(4,6-dichloro-2-ethenyl-3-methylphenoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88965217 |
| Molecular Formula | C15H16Cl2O3 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-(4,6-dichloro-2-ethenyl-3-methylphenoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=Cc1c(C)c(Cl)cc(Cl)c1OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C15H16Cl2O3/c1-5-11-10(4)12(16)8-13(17)14(11)19-6-7-20-15(18)9(2)3/h5,8H,1-2,6-7H2,3-4H3 |
| InChIKey | HVSQXLNTGLKZOX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|