C34H46O10S — CID 139668888
2-[4-[2,5-diethoxy-3-methyl-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]sulfanyl-3,6-diethoxy-2-methylphenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 139668888) has the molecular formula C34H46O10S and a molecular weight of 646.80 g/mol. Its IUPAC name is 2-[4-[2,5-diethoxy-3-methyl-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]sulfanyl-3,6-diethoxy-2-methylphenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[2,5-diethoxy-3-methyl-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]sulfanyl-3,6-diethoxy-2-methylphenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139668888 |
| Molecular Formula | C34H46O10S |
| Molecular Weight | 646.80 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | 2-[4-[2,5-diethoxy-3-methyl-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]sulfanyl-3,6-diethoxy-2-methylphenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1c(OCC)cc(Sc2cc(OCC)c(OCCOC(=O)C(=C)C)c(C)c2OCC)c(OCC)c1C |
| InChI | InChI=1S/C34H46O10S/c1-11-37-25-19-27(31(39-13-3)23(9)29(25)41-15-17-43-33(35)21(5)6)45-28-20-26(38-12-2)30(24(10)32(28)40-14-4)42-16-18-44-34(36)22(7)8/h19-20H,5,7,11-18H2,1-4,6,8-10H3 |
| InChIKey | CRUDMICPIOPMAH-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.80 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|