C14H18O7S — CID 154217964
2-ethoxy-3-[2-(2-methylprop-2-enoyloxy)ethoxy]benzenesulfonic acid (PubChem CID 154217964) has the molecular formula C14H18O7S and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-ethoxy-3-[2-(2-methylprop-2-enoyloxy)ethoxy]benzenesulfonic acid.
| Compound Name | 2-ethoxy-3-[2-(2-methylprop-2-enoyloxy)ethoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 154217964 |
| Molecular Formula | C14H18O7S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-ethoxy-3-[2-(2-methylprop-2-enoyloxy)ethoxy]benzenesulfonic acid |
| SMILES | C=C(C)C(=O)OCCOc1cccc(S(=O)(=O)O)c1OCC |
| InChI | InChI=1S/C14H18O7S/c1-4-19-13-11(6-5-7-12(13)22(16,17)18)20-8-9-21-14(15)10(2)3/h5-7H,2,4,8-9H2,1,3H3,(H,16,17,18) |
| InChIKey | JXOZZLCNQFCSPP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|