C43H64O14 — CID 22590229
2-[2,3,5,6-tetraethoxy-4-[2-[2,3,5,6-tetraethoxy-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 22590229) has the molecular formula C43H64O14 and a molecular weight of 804.97 g/mol. Its IUPAC name is 2-[2,3,5,6-tetraethoxy-4-[2-[2,3,5,6-tetraethoxy-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2,3,5,6-tetraethoxy-4-[2-[2,3,5,6-tetraethoxy-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22590229 |
| Molecular Formula | C43H64O14 |
| Molecular Weight | 804.97 g/mol |
| Exact Mass | 804.43 |
| IUPAC Name | 2-[2,3,5,6-tetraethoxy-4-[2-[2,3,5,6-tetraethoxy-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1c(OCC)c(OCC)c(C(C)(C)c2c(OCC)c(OCC)c(OCCOC(=O)C(=C)C)c(OCC)c2OCC)c(OCC)c1OCC |
| InChI | InChI=1S/C43H64O14/c1-15-46-31-29(32(47-16-2)36(51-20-6)39(35(31)50-19-5)54-23-25-56-41(44)27(9)10)43(13,14)30-33(48-17-3)37(52-21-7)40(38(53-22-8)34(30)49-18-4)55-24-26-57-42(45)28(11)12/h9,11,15-26H2,1-8,10,12-14H3 |
| InChIKey | UZUBLHUYXADZJL-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.97 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|