C53H84O14 — CID 139983551
1-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)propoxy]-2,3,5,6-tetrapropoxyphenyl]propan-2-yl]-2,3,5,6-tetrapropoxyphenoxy]propan-2-yl 2-methylprop-2-enoate (PubChem CID 139983551) has the molecular formula C53H84O14 and a molecular weight of 945.24 g/mol. Its IUPAC name is 1-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)propoxy]-2,3,5,6-tetrapropoxyphenyl]propan-2-yl]-2,3,5,6-tetrapropoxyphenoxy]propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)propoxy]-2,3,5,6-tetrapropoxyphenyl]propan-2-yl]-2,3,5,6-tetrapropoxyphenoxy]propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139983551 |
| Molecular Formula | C53H84O14 |
| Molecular Weight | 945.24 g/mol |
| Exact Mass | 944.59 |
| IUPAC Name | 1-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)propoxy]-2,3,5,6-tetrapropoxyphenyl]propan-2-yl]-2,3,5,6-tetrapropoxyphenoxy]propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)COc1c(OCCC)c(OCCC)c(C(C)(C)c2c(OCCC)c(OCCC)c(OCC(C)OC(=O)C(=C)C)c(OCCC)c2OCCC)c(OCCC)c1OCCC |
| InChI | InChI=1S/C53H84O14/c1-17-25-56-41-39(42(57-26-18-2)46(61-30-22-6)49(45(41)60-29-21-5)64-33-37(13)66-51(54)35(9)10)53(15,16)40-43(58-27-19-3)47(62-31-23-7)50(65-34-38(14)67-52(55)36(11)12)48(63-32-24-8)44(40)59-28-20-4/h37-38H,9,11,17-34H2,1-8,10,12-16H3 |
| InChIKey | PZUZOQPJKQGODE-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.24 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|