C19H24FN3O2 — CID 133388898
propan-2-yl 4-[(6-fluoro-2-methylquinolin-4-yl)amino]piperidine-1-carboxylate (PubChem CID 133388898) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is propan-2-yl 4-[(6-fluoro-2-methylquinolin-4-yl)amino]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[(6-fluoro-2-methylquinolin-4-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 133388898 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | propan-2-yl 4-[(6-fluoro-2-methylquinolin-4-yl)amino]piperidine-1-carboxylate |
| SMILES | Cc1cc(NC2CCN(C(=O)OC(C)C)CC2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C19H24FN3O2/c1-12(2)25-19(24)23-8-6-15(7-9-23)22-18-10-13(3)21-17-5-4-14(20)11-16(17)18/h4-5,10-12,15H,6-9H2,1-3H3,(H,21,22) |
| InChIKey | SULQVECIUDBJTE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |