C15H19FN2O — CID 133388853
1-[(6-fluoro-2-methylquinolin-4-yl)amino]pentan-2-ol (PubChem CID 133388853) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-[(6-fluoro-2-methylquinolin-4-yl)amino]pentan-2-ol.
| Compound Name | 1-[(6-fluoro-2-methylquinolin-4-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 133388853 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-[(6-fluoro-2-methylquinolin-4-yl)amino]pentan-2-ol |
| SMILES | CCCC(O)CNc1cc(C)nc2ccc(F)cc12 |
| InChI | InChI=1S/C15H19FN2O/c1-3-4-12(19)9-17-15-7-10(2)18-14-6-5-11(16)8-13(14)15/h5-8,12,19H,3-4,9H2,1-2H3,(H,17,18) |
| InChIKey | YDYJCXBRGBUMRJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |