C27H31ClN4O — CID 92858360
(1S)-N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-diethyl-1-pyridin-4-ylbutane-1,4-diamine (PubChem CID 92858360) has the molecular formula C27H31ClN4O and a molecular weight of 463.03 g/mol. Its IUPAC name is (1S)-N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-diethyl-1-pyridin-4-ylbutane-1,4-diamine.
| Compound Name | (1S)-N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-diethyl-1-pyridin-4-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 92858360 |
| Molecular Formula | C27H31ClN4O |
| Molecular Weight | 463.03 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (1S)-N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-diethyl-1-pyridin-4-ylbutane-1,4-diamine |
| SMILES | CCN(CC)CCC[C@H](Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12)c1ccncc1 |
| InChI | InChI=1S/C27H31ClN4O/c1-4-32(5-2)16-6-7-24(19-12-14-29-15-13-19)31-27-22-10-8-20(28)17-26(22)30-25-11-9-21(33-3)18-23(25)27/h8-15,17-18,24H,4-7,16H2,1-3H3,(H,30,31)/t24-/m0/s1 |
| InChIKey | UWHHGPUJFLEBJQ-DEOSSOPVSA-N |
| XLogP | 6.72 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.03 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|