C25H25ClN2O3 — CID 4831555
6-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methoxy-N-methylacridin-9-amine (PubChem CID 4831555) has the molecular formula C25H25ClN2O3 and a molecular weight of 436.94 g/mol. Its IUPAC name is 6-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methoxy-N-methylacridin-9-amine.
| Compound Name | 6-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methoxy-N-methylacridin-9-amine |
|---|---|
| PubChem CID | 4831555 |
| Molecular Formula | C25H25ClN2O3 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 6-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methoxy-N-methylacridin-9-amine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(N(C)CCc3ccc(OC)c(OC)c3)c2c1 |
| InChI | InChI=1S/C25H25ClN2O3/c1-28(12-11-16-5-10-23(30-3)24(13-16)31-4)25-19-8-6-17(26)14-22(19)27-21-9-7-18(29-2)15-20(21)25/h5-10,13-15H,11-12H2,1-4H3 |
| InChIKey | JSIGEHVKICPRGW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|