C23H30ClN3O — CID 141235357
2-N-(6-chloro-2-methoxyacridin-9-yl)-2-N',2-N'-diethylpentane-2,2-diamine (PubChem CID 141235357) has the molecular formula C23H30ClN3O and a molecular weight of 399.97 g/mol. Its IUPAC name is 2-N-(6-chloro-2-methoxyacridin-9-yl)-2-N',2-N'-diethylpentane-2,2-diamine.
| Compound Name | 2-N-(6-chloro-2-methoxyacridin-9-yl)-2-N',2-N'-diethylpentane-2,2-diamine |
|---|---|
| PubChem CID | 141235357 |
| Molecular Formula | C23H30ClN3O |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-N-(6-chloro-2-methoxyacridin-9-yl)-2-N',2-N'-diethylpentane-2,2-diamine |
| SMILES | CCCC(C)(Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12)N(CC)CC |
| InChI | InChI=1S/C23H30ClN3O/c1-6-13-23(4,27(7-2)8-3)26-22-18-11-9-16(24)14-21(18)25-20-12-10-17(28-5)15-19(20)22/h9-12,14-15H,6-8,13H2,1-5H3,(H,25,26) |
| InChIKey | SGCIEICPYWBIMY-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|