C26H37ClN3O+ — CID 163985999
4-[(6-chloro-2-methoxyacridin-9-yl)amino]pentyl-diethyl-propan-2-ylazanium (PubChem CID 163985999) has the molecular formula C26H37ClN3O+ and a molecular weight of 443.06 g/mol. Its IUPAC name is 4-[(6-chloro-2-methoxyacridin-9-yl)amino]pentyl-diethyl-propan-2-ylazanium.
| Compound Name | 4-[(6-chloro-2-methoxyacridin-9-yl)amino]pentyl-diethyl-propan-2-ylazanium |
|---|---|
| PubChem CID | 163985999 |
| Molecular Formula | C26H37ClN3O+ |
| Molecular Weight | 443.06 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 4-[(6-chloro-2-methoxyacridin-9-yl)amino]pentyl-diethyl-propan-2-ylazanium |
| SMILES | CC[N+](CC)(CCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12)C(C)C |
| InChI | InChI=1S/C26H37ClN3O/c1-7-30(8-2,18(3)4)15-9-10-19(5)28-26-22-13-11-20(27)16-25(22)29-24-14-12-21(31-6)17-23(24)26/h11-14,16-19H,7-10,15H2,1-6H3,(H,28,29)/q+1 |
| InChIKey | GXYJMINVCYPYFR-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.06 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|